C22H31NO2 — CID 174821550
(3,3,5,5-tetramethyl-4-piperidin-1-ylcyclohexen-1-yl) benzoate (PubChem CID 174821550) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (3,3,5,5-tetramethyl-4-piperidin-1-ylcyclohexen-1-yl) benzoate.
| Compound Name | (3,3,5,5-tetramethyl-4-piperidin-1-ylcyclohexen-1-yl) benzoate |
|---|---|
| PubChem CID | 174821550 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (3,3,5,5-tetramethyl-4-piperidin-1-ylcyclohexen-1-yl) benzoate |
| SMILES | CC1(C)C=C(OC(=O)c2ccccc2)CC(C)(C)C1N1CCCCC1 |
| InChI | InChI=1S/C22H31NO2/c1-21(2)15-18(25-19(24)17-11-7-5-8-12-17)16-22(3,4)20(21)23-13-9-6-10-14-23/h5,7-8,11-12,15,20H,6,9-10,13-14,16H2,1-4H3 |
| InChIKey | YPNLEURHDPEOEJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |