C14H24N2O3 — CID 174822105
2-amino-3-(4-tert-butylphenyl)propan-1-ol;carbamic acid (PubChem CID 174822105) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-amino-3-(4-tert-butylphenyl)propan-1-ol;carbamic acid.
| Compound Name | 2-amino-3-(4-tert-butylphenyl)propan-1-ol;carbamic acid |
|---|---|
| PubChem CID | 174822105 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 2-amino-3-(4-tert-butylphenyl)propan-1-ol;carbamic acid |
| SMILES | CC(C)(C)c1ccc(CC(N)CO)cc1.NC(=O)O |
| InChI | InChI=1S/C13H21NO.CH3NO2/c1-13(2,3)11-6-4-10(5-7-11)8-12(14)9-15;2-1(3)4/h4-7,12,15H,8-9,14H2,1-3H3;2H2,(H,3,4) |
| InChIKey | BFFKTSPGRKSZOP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |