About 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid
1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid (PubChem CID 174822852) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid.
Molecular Properties
| Compound Name | 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid |
| PubChem CID | 174822852 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid |
| SMILES | O=C(O)C(S)c1ccccc1.c1cnc2nc[nH]c2c1 |
| InChI | InChI=1S/C8H8O2S.C6H5N3/c9-8(10)7(11)6-4-2-1-3-5-6;1-2-5-6(7-3-1)9-4-8-5/h1-5,7,11H,(H,9,10);1-4H,(H,7,8,9) |
| InChIKey | QVIIYRNFOITSQT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid?
The IUPAC name of 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid (CID 174822852) is 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid.
What is the SMILES notation for 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid?
The canonical SMILES for 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid is O=C(O)C(S)c1ccccc1.c1cnc2nc[nH]c2c1.
What is the InChIKey of 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid?
The InChIKey is QVIIYRNFOITSQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2S.C6H5N3/c9-8(10)7(11)6-4-2-1-3-5-6;1-2-5-6(7-3-1)9-4-8-5/h1-5,7,11H,(H,9,10);1-4H,(H,7,8,9).
What are the key properties of 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid?
1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid has a molecular weight of 287.34 g/mol, XLogP of 2.70, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazo[4,5-b]pyridine;2-phenyl-2-sulfanylacetic acid is sourced from PubChem (CID 174822852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).