C16H15N5OS — CID 17482304
4-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethoxy]benzonitrile (PubChem CID 17482304) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is 4-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 17482304 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-[2-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)sulfanyl]ethoxy]benzonitrile |
| SMILES | Cc1cc(C)n2c(SCCOc3ccc(C#N)cc3)nnc2n1 |
| InChI | InChI=1S/C16H15N5OS/c1-11-9-12(2)21-15(18-11)19-20-16(21)23-8-7-22-14-5-3-13(10-17)4-6-14/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | SEBJEGLVGLQENI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|