About azane;3-bromo-1,1,3-triethoxyprop-1-ene
azane;3-bromo-1,1,3-triethoxyprop-1-ene (PubChem CID 174823250) has the molecular formula C9H20BrNO3
and a molecular weight of 270.17 g/mol. Its IUPAC name is azane;3-bromo-1,1,3-triethoxyprop-1-ene.
Molecular Properties
| Compound Name | azane;3-bromo-1,1,3-triethoxyprop-1-ene |
| PubChem CID | 174823250 |
| Molecular Formula | C9H20BrNO3 |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | azane;3-bromo-1,1,3-triethoxyprop-1-ene |
| SMILES | CCOC(=CC(Br)OCC)OCC.N |
| InChI | InChI=1S/C9H17BrO3.H3N/c1-4-11-8(10)7-9(12-5-2)13-6-3;/h7-8H,4-6H2,1-3H3;1H3 |
| InChIKey | GHZSMIJEYCQTLN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;3-bromo-1,1,3-triethoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-bromo-1,1,3-triethoxyprop-1-ene?
The IUPAC name of azane;3-bromo-1,1,3-triethoxyprop-1-ene (CID 174823250) is azane;3-bromo-1,1,3-triethoxyprop-1-ene.
What is the SMILES notation for azane;3-bromo-1,1,3-triethoxyprop-1-ene?
The canonical SMILES for azane;3-bromo-1,1,3-triethoxyprop-1-ene is CCOC(=CC(Br)OCC)OCC.N.
What is the InChIKey of azane;3-bromo-1,1,3-triethoxyprop-1-ene?
The InChIKey is GHZSMIJEYCQTLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrO3.H3N/c1-4-11-8(10)7-9(12-5-2)13-6-3;/h7-8H,4-6H2,1-3H3;1H3.
What are the key properties of azane;3-bromo-1,1,3-triethoxyprop-1-ene?
azane;3-bromo-1,1,3-triethoxyprop-1-ene has a molecular weight of 270.17 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-bromo-1,1,3-triethoxyprop-1-ene is sourced from PubChem (CID 174823250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).