About N-cyclopropyl-2-fluoro-N,5-dimethylaniline
N-cyclopropyl-2-fluoro-N,5-dimethylaniline (PubChem CID 174823652) has the molecular formula C11H14FN
and a molecular weight of 179.24 g/mol. Its IUPAC name is N-cyclopropyl-2-fluoro-N,5-dimethylaniline.
Molecular Properties
| Compound Name | N-cyclopropyl-2-fluoro-N,5-dimethylaniline |
| PubChem CID | 174823652 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-cyclopropyl-2-fluoro-N,5-dimethylaniline |
| SMILES | Cc1ccc(F)c(N(C)C2CC2)c1 |
| InChI | InChI=1S/C11H14FN/c1-8-3-6-10(12)11(7-8)13(2)9-4-5-9/h3,6-7,9H,4-5H2,1-2H3 |
| InChIKey | SSLDRYSVLBHOQF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropyl-2-fluoro-N,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-fluoro-N,5-dimethylaniline?
The IUPAC name of N-cyclopropyl-2-fluoro-N,5-dimethylaniline (CID 174823652) is N-cyclopropyl-2-fluoro-N,5-dimethylaniline.
What is the SMILES notation for N-cyclopropyl-2-fluoro-N,5-dimethylaniline?
The canonical SMILES for N-cyclopropyl-2-fluoro-N,5-dimethylaniline is Cc1ccc(F)c(N(C)C2CC2)c1.
What is the InChIKey of N-cyclopropyl-2-fluoro-N,5-dimethylaniline?
The InChIKey is SSLDRYSVLBHOQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN/c1-8-3-6-10(12)11(7-8)13(2)9-4-5-9/h3,6-7,9H,4-5H2,1-2H3.
What are the key properties of N-cyclopropyl-2-fluoro-N,5-dimethylaniline?
N-cyclopropyl-2-fluoro-N,5-dimethylaniline has a molecular weight of 179.24 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-fluoro-N,5-dimethylaniline is sourced from PubChem (CID 174823652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).