C6H15BO5 — CID 174823808
ethoxy-[2-(2-hydroxyethoxy)ethoxy]borinic acid (PubChem CID 174823808) has the molecular formula C6H15BO5 and a molecular weight of 177.99 g/mol. Its IUPAC name is ethoxy-[2-(2-hydroxyethoxy)ethoxy]borinic acid.
| Compound Name | ethoxy-[2-(2-hydroxyethoxy)ethoxy]borinic acid |
|---|---|
| PubChem CID | 174823808 |
| Molecular Formula | C6H15BO5 |
| Molecular Weight | 177.99 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | ethoxy-[2-(2-hydroxyethoxy)ethoxy]borinic acid |
| SMILES | CCOB(O)OCCOCCO |
| InChI | InChI=1S/C6H15BO5/c1-2-11-7(9)12-6-5-10-4-3-8/h8-9H,2-6H2,1H3 |
| InChIKey | BGBIXSJYPODZRX-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.99 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|