About 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide
1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide (PubChem CID 174823930) has the molecular formula C11H12Br3IN2O2
and a molecular weight of 570.85 g/mol. Its IUPAC name is 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide.
Molecular Properties
| Compound Name | 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide |
| PubChem CID | 174823930 |
| Molecular Formula | C11H12Br3IN2O2 |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 567.75 |
| IUPAC Name | 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide |
| SMILES | Br.CC1(C)C(=O)N(Br)C(=O)N1Br.Ic1ccccc1 |
| InChI | InChI=1S/C6H5I.C5H6Br2N2O2.BrH/c7-6-4-2-1-3-5-6;1-5(2)3(10)8(6)4(11)9(5)7;/h1-5H;1-2H3;1H |
| InChIKey | PPNMVHUZJIUUCW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide?
The IUPAC name of 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide (CID 174823930) is 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide.
What is the SMILES notation for 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide?
The canonical SMILES for 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide is Br.CC1(C)C(=O)N(Br)C(=O)N1Br.Ic1ccccc1.
What is the InChIKey of 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide?
The InChIKey is PPNMVHUZJIUUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5I.C5H6Br2N2O2.BrH/c7-6-4-2-1-3-5-6;1-5(2)3(10)8(6)4(11)9(5)7;/h1-5H;1-2H3;1H.
What are the key properties of 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide?
1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide has a molecular weight of 570.85 g/mol, XLogP of 4.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-5,5-dimethylimidazolidine-2,4-dione;iodobenzene;hydrobromide is sourced from PubChem (CID 174823930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).