About 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole
4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole (PubChem CID 174824500) has the molecular formula C11H20N4O
and a molecular weight of 224.31 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole.
Molecular Properties
| Compound Name | 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole |
| PubChem CID | 174824500 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole |
| SMILES | C1=NCCO1.C1CCNCC1.c1cn[nH]c1 |
| InChI | InChI=1S/C5H11N.C3H4N2.C3H5NO/c1-2-4-6-5-3-1;1-2-4-5-3-1;1-2-5-3-4-1/h6H,1-5H2;1-3H,(H,4,5);3H,1-2H2 |
| InChIKey | RHVNMOQTZKMKSQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole?
The IUPAC name of 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole (CID 174824500) is 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole.
What is the SMILES notation for 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole?
The canonical SMILES for 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole is C1=NCCO1.C1CCNCC1.c1cn[nH]c1.
What is the InChIKey of 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole?
The InChIKey is RHVNMOQTZKMKSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.C3H4N2.C3H5NO/c1-2-4-6-5-3-1;1-2-4-5-3-1;1-2-5-3-4-1/h6H,1-5H2;1-3H,(H,4,5);3H,1-2H2.
What are the key properties of 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole?
4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole has a molecular weight of 224.31 g/mol, XLogP of 1.21, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,3-oxazole;piperidine;1H-pyrazole is sourced from PubChem (CID 174824500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).