About tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate
tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 174824954) has the molecular formula C16H19ClN4O3S
and a molecular weight of 382.87 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 174824954 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(C(=O)Nc2c(Cl)cccc2CN)s1 |
| InChI | InChI=1S/C16H19ClN4O3S/c1-16(2,3)24-15(23)21-14-19-8-11(25-14)13(22)20-12-9(7-18)5-4-6-10(12)17/h4-6,8H,7,18H2,1-3H3,(H,20,22)(H,19,21,23) |
| InChIKey | XNCAPTXFESOPQV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate?
The IUPAC name of tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate (CID 174824954) is tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate is CC(C)(C)OC(=O)Nc1ncc(C(=O)Nc2c(Cl)cccc2CN)s1.
What is the InChIKey of tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate?
The InChIKey is XNCAPTXFESOPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4O3S/c1-16(2,3)24-15(23)21-14-19-8-11(25-14)13(22)20-12-9(7-18)5-4-6-10(12)17/h4-6,8H,7,18H2,1-3H3,(H,20,22)(H,19,21,23).
What are the key properties of tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate?
tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate has a molecular weight of 382.87 g/mol, XLogP of 3.85, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-[[2-(aminomethyl)-6-chlorophenyl]carbamoyl]-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 174824954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).