C26H23ClO — CID 174825712
1-chloro-1,2,3,4-tetrahydrochrysene;1-phenylethanone (PubChem CID 174825712) has the molecular formula C26H23ClO and a molecular weight of 386.92 g/mol. Its IUPAC name is 1-chloro-1,2,3,4-tetrahydrochrysene;1-phenylethanone.
| Compound Name | 1-chloro-1,2,3,4-tetrahydrochrysene;1-phenylethanone |
|---|---|
| PubChem CID | 174825712 |
| Molecular Formula | C26H23ClO |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-chloro-1,2,3,4-tetrahydrochrysene;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.ClC1CCCc2c1ccc1c2ccc2ccccc21 |
| InChI | InChI=1S/C18H15Cl.C8H8O/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;1-7(9)8-5-3-2-4-6-8/h1-2,4-5,8-11,18H,3,6-7H2;2-6H,1H3 |
| InChIKey | OXHCVXTWMQTWKX-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|