About 21-methyl-22,23-dihydroporphyrin-2-one
21-methyl-22,23-dihydroporphyrin-2-one (PubChem CID 174825894) has the molecular formula C21H16N4O
and a molecular weight of 340.39 g/mol. Its IUPAC name is 21-methyl-22,23-dihydroporphyrin-2-one.
Molecular Properties
| Compound Name | 21-methyl-22,23-dihydroporphyrin-2-one |
| PubChem CID | 174825894 |
| Molecular Formula | C21H16N4O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 21-methyl-22,23-dihydroporphyrin-2-one |
| SMILES | CN1C2=CC(=O)/C1=C/C1=N/C(=C\c3ccc([nH]3)/C=c3/cc/c([nH]3)=C/2)C=C1 |
| InChI | InChI=1S/C21H16N4O/c1-25-19-10-17-6-4-15(23-17)8-13-2-3-14(22-13)9-16-5-7-18(24-16)11-20(25)21(26)12-19/h2-12,22-23H,1H3/b15-8-,16-9-,17-10-,20-11- |
| InChIKey | NKHOECRDLPWEMQ-TUNVJQRFSA-N |
| XLogP | 1.60 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 21-methyl-22,23-dihydroporphyrin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21-methyl-22,23-dihydroporphyrin-2-one?
The IUPAC name of 21-methyl-22,23-dihydroporphyrin-2-one (CID 174825894) is 21-methyl-22,23-dihydroporphyrin-2-one.
What is the SMILES notation for 21-methyl-22,23-dihydroporphyrin-2-one?
The canonical SMILES for 21-methyl-22,23-dihydroporphyrin-2-one is CN1C2=CC(=O)/C1=C/C1=N/C(=C\c3ccc([nH]3)/C=c3/cc/c([nH]3)=C/2)C=C1.
What is the InChIKey of 21-methyl-22,23-dihydroporphyrin-2-one?
The InChIKey is NKHOECRDLPWEMQ-TUNVJQRFSA-N. The full InChI is InChI=1S/C21H16N4O/c1-25-19-10-17-6-4-15(23-17)8-13-2-3-14(22-13)9-16-5-7-18(24-16)11-20(25)21(26)12-19/h2-12,22-23H,1H3/b15-8-,16-9-,17-10-,20-11-.
What are the key properties of 21-methyl-22,23-dihydroporphyrin-2-one?
21-methyl-22,23-dihydroporphyrin-2-one has a molecular weight of 340.39 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 21-methyl-22,23-dihydroporphyrin-2-one is sourced from PubChem (CID 174825894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).