About 2,2-dimethyloxasilinane;naphthalen-2-ol
2,2-dimethyloxasilinane;naphthalen-2-ol (PubChem CID 174826111) has the molecular formula C16H22O2Si
and a molecular weight of 274.44 g/mol. Its IUPAC name is 2,2-dimethyloxasilinane;naphthalen-2-ol.
Molecular Properties
| Compound Name | 2,2-dimethyloxasilinane;naphthalen-2-ol |
| PubChem CID | 174826111 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2,2-dimethyloxasilinane;naphthalen-2-ol |
| SMILES | C[Si]1(C)CCCCO1.Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.C6H14OSi/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-8(2)6-4-3-5-7-8/h1-7,11H;3-6H2,1-2H3 |
| InChIKey | RMHLTJFWDDJYQZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyloxasilinane;naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyloxasilinane;naphthalen-2-ol?
The IUPAC name of 2,2-dimethyloxasilinane;naphthalen-2-ol (CID 174826111) is 2,2-dimethyloxasilinane;naphthalen-2-ol.
What is the SMILES notation for 2,2-dimethyloxasilinane;naphthalen-2-ol?
The canonical SMILES for 2,2-dimethyloxasilinane;naphthalen-2-ol is C[Si]1(C)CCCCO1.Oc1ccc2ccccc2c1.
What is the InChIKey of 2,2-dimethyloxasilinane;naphthalen-2-ol?
The InChIKey is RMHLTJFWDDJYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C6H14OSi/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-8(2)6-4-3-5-7-8/h1-7,11H;3-6H2,1-2H3.
What are the key properties of 2,2-dimethyloxasilinane;naphthalen-2-ol?
2,2-dimethyloxasilinane;naphthalen-2-ol has a molecular weight of 274.44 g/mol, XLogP of 4.55, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyloxasilinane;naphthalen-2-ol is sourced from PubChem (CID 174826111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).