About 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole
2-indolizin-3-yl-4,5-dihydro-1,3-thiazole (PubChem CID 174826542) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole |
| PubChem CID | 174826542 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole |
| SMILES | c1ccn2c(C3=NCCS3)ccc2c1 |
| InChI | InChI=1S/C11H10N2S/c1-2-7-13-9(3-1)4-5-10(13)11-12-6-8-14-11/h1-5,7H,6,8H2 |
| InChIKey | PHECKHKBCWUXRS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole (CID 174826542) is 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole is c1ccn2c(C3=NCCS3)ccc2c1.
What is the InChIKey of 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole?
The InChIKey is PHECKHKBCWUXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-2-7-13-9(3-1)4-5-10(13)11-12-6-8-14-11/h1-5,7H,6,8H2.
What are the key properties of 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole?
2-indolizin-3-yl-4,5-dihydro-1,3-thiazole has a molecular weight of 202.28 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-indolizin-3-yl-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 174826542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).