C23H25N — CID 174827036
1,2-dihydropyridine;1,2,3,4,8,9-hexahydrochrysene (PubChem CID 174827036) has the molecular formula C23H25N and a molecular weight of 315.46 g/mol. Its IUPAC name is 1,2-dihydropyridine;1,2,3,4,8,9-hexahydrochrysene.
| Compound Name | 1,2-dihydropyridine;1,2,3,4,8,9-hexahydrochrysene |
|---|---|
| PubChem CID | 174827036 |
| Molecular Formula | C23H25N |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1,2-dihydropyridine;1,2,3,4,8,9-hexahydrochrysene |
| SMILES | C1=CCNC=C1.C1=c2ccc3c4c(ccc3c2=CCC1)CCCC4 |
| InChI | InChI=1S/C18H18.C5H7N/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-4-6-5-3-1/h5,7,9-12H,1-4,6,8H2;1-4,6H,5H2 |
| InChIKey | JKQMQWMIOZVBJL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |