About ethanol;bis(1H-pyridin-2-one)
ethanol;bis(1H-pyridin-2-one) (PubChem CID 174827377) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is ethanol;bis(1H-pyridin-2-one).
Molecular Properties
| Compound Name | ethanol;bis(1H-pyridin-2-one) |
| PubChem CID | 174827377 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethanol;bis(1H-pyridin-2-one) |
| SMILES | CCO.O=c1cccc[nH]1.O=c1cccc[nH]1 |
| InChI | InChI=1S/2C5H5NO.C2H6O/c2*7-5-3-1-2-4-6-5;1-2-3/h2*1-4H,(H,6,7);3H,2H2,1H3 |
| InChIKey | FMHZKKPTDKLEBD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethanol;bis(1H-pyridin-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;bis(1H-pyridin-2-one)?
The IUPAC name of ethanol;bis(1H-pyridin-2-one) (CID 174827377) is ethanol;bis(1H-pyridin-2-one).
What is the SMILES notation for ethanol;bis(1H-pyridin-2-one)?
The canonical SMILES for ethanol;bis(1H-pyridin-2-one) is CCO.O=c1cccc[nH]1.O=c1cccc[nH]1.
What is the InChIKey of ethanol;bis(1H-pyridin-2-one)?
The InChIKey is FMHZKKPTDKLEBD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5NO.C2H6O/c2*7-5-3-1-2-4-6-5;1-2-3/h2*1-4H,(H,6,7);3H,2H2,1H3.
What are the key properties of ethanol;bis(1H-pyridin-2-one)?
ethanol;bis(1H-pyridin-2-one) has a molecular weight of 236.27 g/mol, XLogP of 0.75, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;bis(1H-pyridin-2-one) is sourced from PubChem (CID 174827377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).