About benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole
benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole (PubChem CID 174828728) has the molecular formula C20H19N5O3
and a molecular weight of 377.40 g/mol. Its IUPAC name is benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole.
Molecular Properties
| Compound Name | benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole |
| PubChem CID | 174828728 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole |
| SMILES | Nc1ccc(N)cc1.O=Cc1ccccc1.O=[N+]([O-])c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C7H5N3O2.C7H6O.C6H8N2/c11-10(12)7-8-5-3-1-2-4-6(5)9-7;8-6-7-4-2-1-3-5-7;7-5-1-2-6(8)4-3-5/h1-4H,(H,8,9);1-6H;1-4H,7-8H2 |
| InChIKey | BTNQRBXLJOAGHB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole?
The IUPAC name of benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole (CID 174828728) is benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole.
What is the SMILES notation for benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole?
The canonical SMILES for benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole is Nc1ccc(N)cc1.O=Cc1ccccc1.O=[N+]([O-])c1nc2ccccc2[nH]1.
What is the InChIKey of benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole?
The InChIKey is BTNQRBXLJOAGHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2.C7H6O.C6H8N2/c11-10(12)7-8-5-3-1-2-4-6(5)9-7;8-6-7-4-2-1-3-5-7;7-5-1-2-6(8)4-3-5/h1-4H,(H,8,9);1-6H;1-4H,7-8H2.
What are the key properties of benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole?
benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole has a molecular weight of 377.40 g/mol, XLogP of 3.82, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;benzene-1,4-diamine;2-nitro-1H-benzimidazole is sourced from PubChem (CID 174828728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).