C18H14F2 — CID 174828808
7,9-difluoro-2,3,4,5-tetrahydrochrysene (PubChem CID 174828808) has the molecular formula C18H14F2 and a molecular weight of 268.31 g/mol. Its IUPAC name is 7,9-difluoro-2,3,4,5-tetrahydrochrysene.
| Compound Name | 7,9-difluoro-2,3,4,5-tetrahydrochrysene |
|---|---|
| PubChem CID | 174828808 |
| Molecular Formula | C18H14F2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 7,9-difluoro-2,3,4,5-tetrahydrochrysene |
| SMILES | Fc1cc(F)c2c(c1)=c1ccc3c(c1CC=2)CCCC=3 |
| InChI | InChI=1S/C18H14F2/c19-12-9-17-15-6-5-11-3-1-2-4-13(11)14(15)7-8-16(17)18(20)10-12/h3,5-6,8-10H,1-2,4,7H2 |
| InChIKey | JRDIAUOBEPKDDY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |