About 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide
3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide (PubChem CID 174829083) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide.
Molecular Properties
| Compound Name | 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide |
| PubChem CID | 174829083 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC.CN(C)CCCO |
| InChI | InChI=1S/C7H13NO.C5H13NO/c1-4-5-8-7(9)6(2)3;1-6(2)4-3-5-7/h2,4-5H2,1,3H3,(H,8,9);7H,3-5H2,1-2H3 |
| InChIKey | OIOMIAJGVZCOJH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide?
The IUPAC name of 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide (CID 174829083) is 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide.
What is the SMILES notation for 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide?
The canonical SMILES for 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide is C=C(C)C(=O)NCCC.CN(C)CCCO.
What is the InChIKey of 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide?
The InChIKey is OIOMIAJGVZCOJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C5H13NO/c1-4-5-8-7(9)6(2)3;1-6(2)4-3-5-7/h2,4-5H2,1,3H3,(H,8,9);7H,3-5H2,1-2H3.
What are the key properties of 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide?
3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide has a molecular weight of 230.35 g/mol, XLogP of 1.02, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propan-1-ol;2-methyl-N-propylprop-2-enamide is sourced from PubChem (CID 174829083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).