C16H23NO4 — CID 174829179
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-prop-2-enylpyrrolidine (PubChem CID 174829179) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-prop-2-enylpyrrolidine.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-prop-2-enylpyrrolidine |
|---|---|
| PubChem CID | 174829179 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;1-prop-2-enylpyrrolidine |
| SMILES | C=CCN1CCCC1.CC1(C(=O)O)C=CC=C(C(=O)O)C1 |
| InChI | InChI=1S/C9H10O4.C7H13N/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-5-8-6-3-4-7-8/h2-4H,5H2,1H3,(H,10,11)(H,12,13);2H,1,3-7H2 |
| InChIKey | STCUCDVSEDZADB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|