About 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine
4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine (PubChem CID 174829931) has the molecular formula C20H28N2O
and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine |
| PubChem CID | 174829931 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(Oc2ccc(N)cc2N)c1 |
| InChI | InChI=1S/C20H28N2O/c1-19(2,3)13-7-9-15(20(4,5)6)18(11-13)23-17-10-8-14(21)12-16(17)22/h7-12H,21-22H2,1-6H3 |
| InChIKey | TWZCXVGIGFLPHN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine?
The IUPAC name of 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine (CID 174829931) is 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine.
What is the SMILES notation for 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine?
The canonical SMILES for 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine is CC(C)(C)c1ccc(C(C)(C)C)c(Oc2ccc(N)cc2N)c1.
What is the InChIKey of 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine?
The InChIKey is TWZCXVGIGFLPHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N2O/c1-19(2,3)13-7-9-15(20(4,5)6)18(11-13)23-17-10-8-14(21)12-16(17)22/h7-12H,21-22H2,1-6H3.
What are the key properties of 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine?
4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine has a molecular weight of 312.46 g/mol, XLogP of 5.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-ditert-butylphenoxy)benzene-1,3-diamine is sourced from PubChem (CID 174829931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).