About 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde
4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde (PubChem CID 174830558) has the molecular formula C46H28N4O2
and a molecular weight of 668.76 g/mol. Its IUPAC name is 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde.
Molecular Properties
| Compound Name | 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde |
| PubChem CID | 174830558 |
| Molecular Formula | C46H28N4O2 |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde |
| SMILES | O=Cc1ccc(C2=C(c3ccc(C=O)cc3)/C3=C/C4=N/C(=C(/c5ccccc5)C5=N/C(=C\C6=N/C(=C(/c7ccccc7)C2=N3)C=C6)C=C5)C=C4)cc1 |
| InChI | InChI=1S/C46H28N4O2/c51-27-29-11-15-33(16-12-29)43-41-26-37-21-23-39(49-37)42(31-7-3-1-4-8-31)38-22-19-35(47-38)25-36-20-24-40(48-36)44(32-9-5-2-6-10-32)46(50-41)45(43)34-17-13-30(28-52)14-18-34/h1-28H/b35-25-,36-25-,37-26-,41-26-,42-38-,42-39-,44-40-,46-44- |
| InChIKey | OTAHNDRCLVFIBH-SHPHPMIQSA-N |
| XLogP | 9.31 |
| TPSA | 83.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde?
The IUPAC name of 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde (CID 174830558) is 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde.
What is the SMILES notation for 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde?
The canonical SMILES for 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde is O=Cc1ccc(C2=C(c3ccc(C=O)cc3)/C3=C/C4=N/C(=C(/c5ccccc5)C5=N/C(=C\C6=N/C(=C(/c7ccccc7)C2=N3)C=C6)C=C5)C=C4)cc1.
What is the InChIKey of 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde?
The InChIKey is OTAHNDRCLVFIBH-SHPHPMIQSA-N. The full InChI is InChI=1S/C46H28N4O2/c51-27-29-11-15-33(16-12-29)43-41-26-37-21-23-39(49-37)42(31-7-3-1-4-8-31)38-22-19-35(47-38)25-36-20-24-40(48-36)44(32-9-5-2-6-10-32)46(50-41)45(43)34-17-13-30(28-52)14-18-34/h1-28H/b35-25-,36-25-,37-26-,41-26-,42-38-,42-39-,44-40-,46-44-.
What are the key properties of 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde?
4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde has a molecular weight of 668.76 g/mol, XLogP of 9.31, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-formylphenyl)-5,15-diphenylporphyrin-2-yl]benzaldehyde is sourced from PubChem (CID 174830558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).