C10H10ClN3S — CID 174830625
6-[(4-chlorophenyl)methyl]-2,3-dihydro-1,2,4-triazine-3-thiol (PubChem CID 174830625) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-2,3-dihydro-1,2,4-triazine-3-thiol.
| Compound Name | 6-[(4-chlorophenyl)methyl]-2,3-dihydro-1,2,4-triazine-3-thiol |
|---|---|
| PubChem CID | 174830625 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-2,3-dihydro-1,2,4-triazine-3-thiol |
| SMILES | SC1N=CC(Cc2ccc(Cl)cc2)=NN1 |
| InChI | InChI=1S/C10H10ClN3S/c11-8-3-1-7(2-4-8)5-9-6-12-10(15)14-13-9/h1-4,6,10,14-15H,5H2 |
| InChIKey | YZPIWCPCNQZLPM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|