About iron(2+);nitrite;sulfate
iron(2+);nitrite;sulfate (PubChem CID 174830738) has the molecular formula FeNO6S-
and a molecular weight of 197.91 g/mol. Its IUPAC name is iron(2+);nitrite;sulfate.
Molecular Properties
| Compound Name | iron(2+);nitrite;sulfate |
| PubChem CID | 174830738 |
| Molecular Formula | FeNO6S- |
| Molecular Weight | 197.91 g/mol |
| Exact Mass | 197.88 |
| IUPAC Name | iron(2+);nitrite;sulfate |
| SMILES | O=N[O-].O=S(=O)([O-])[O-].[Fe+2] |
| InChI | InChI=1S/Fe.HNO2.H2O4S/c;2-1-3;1-5(2,3)4/h;(H,2,3);(H2,1,2,3,4)/q+2;;/p-3 |
| InChIKey | ZDLQXZQGETZCQP-UHFFFAOYSA-K |
| XLogP | -1.09 |
| TPSA | 132.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.91 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze iron(2+);nitrite;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron(2+);nitrite;sulfate?
The IUPAC name of iron(2+);nitrite;sulfate (CID 174830738) is iron(2+);nitrite;sulfate.
What is the SMILES notation for iron(2+);nitrite;sulfate?
The canonical SMILES for iron(2+);nitrite;sulfate is O=N[O-].O=S(=O)([O-])[O-].[Fe+2].
What is the InChIKey of iron(2+);nitrite;sulfate?
The InChIKey is ZDLQXZQGETZCQP-UHFFFAOYSA-K. The full InChI is InChI=1S/Fe.HNO2.H2O4S/c;2-1-3;1-5(2,3)4/h;(H,2,3);(H2,1,2,3,4)/q+2;;/p-3.
What are the key properties of iron(2+);nitrite;sulfate?
iron(2+);nitrite;sulfate has a molecular weight of 197.91 g/mol, XLogP of -1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for iron(2+);nitrite;sulfate is sourced from PubChem (CID 174830738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).