C21H46Cl2N2 — CID 174830879
1,2-dimethyl-2,3,3-tripentylpiperazine;dihydrochloride (PubChem CID 174830879) has the molecular formula C21H46Cl2N2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1,2-dimethyl-2,3,3-tripentylpiperazine;dihydrochloride.
| Compound Name | 1,2-dimethyl-2,3,3-tripentylpiperazine;dihydrochloride |
|---|---|
| PubChem CID | 174830879 |
| Molecular Formula | C21H46Cl2N2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1,2-dimethyl-2,3,3-tripentylpiperazine;dihydrochloride |
| SMILES | CCCCCC1(CCCCC)NCCN(C)C1(C)CCCCC.Cl.Cl |
| InChI | InChI=1S/C21H44N2.2ClH/c1-6-9-12-15-20(4)21(16-13-10-7-2,17-14-11-8-3)22-18-19-23(20)5;;/h22H,6-19H2,1-5H3;2*1H |
| InChIKey | SELVJJCQAHJZGG-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|