About benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate
benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate (PubChem CID 174831737) has the molecular formula C13H11F5O5S
and a molecular weight of 374.28 g/mol. Its IUPAC name is benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate.
Molecular Properties
| Compound Name | benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate |
| PubChem CID | 174831737 |
| Molecular Formula | C13H11F5O5S |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate |
| SMILES | O=COc1cccc(S(F)(F)(F)(F)F)c1.Oc1cccc(O)c1O |
| InChI | InChI=1S/C7H5F5O2S.C6H6O3/c8-15(9,10,11,12)7-3-1-2-6(4-7)14-5-13;7-4-2-1-3-5(8)6(4)9/h1-5H;1-3,7-9H |
| InChIKey | QNNLCWJHRLLMMJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate?
The IUPAC name of benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate (CID 174831737) is benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate.
What is the SMILES notation for benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate?
The canonical SMILES for benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate is O=COc1cccc(S(F)(F)(F)(F)F)c1.Oc1cccc(O)c1O.
What is the InChIKey of benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate?
The InChIKey is QNNLCWJHRLLMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F5O2S.C6H6O3/c8-15(9,10,11,12)7-3-1-2-6(4-7)14-5-13;7-4-2-1-3-5(8)6(4)9/h1-5H;1-3,7-9H.
What are the key properties of benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate?
benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate has a molecular weight of 374.28 g/mol, XLogP of 4.68, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2,3-triol;[3-(pentafluoro-λ6-sulfanyl)phenyl] formate is sourced from PubChem (CID 174831737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).