C28H35N5O9 — CID 174832071
4,7-dimethylidene-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,7a-dihydroisoindole-1,3-dione;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 174832071) has the molecular formula C28H35N5O9 and a molecular weight of 585.61 g/mol. Its IUPAC name is 4,7-dimethylidene-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,7a-dihydroisoindole-1,3-dione;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 4,7-dimethylidene-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,7a-dihydroisoindole-1,3-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 174832071 |
| Molecular Formula | C28H35N5O9 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 4,7-dimethylidene-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-3a,7a-dihydroisoindole-1,3-dione;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | C=C1C=CC(=C)C2C(=O)N(CCCCN3CCN(c4ncccn4)CC3)C(=O)C12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H27N5O2.C6H8O7/c1-16-6-7-17(2)19-18(16)20(28)27(21(19)29)11-4-3-10-25-12-14-26(15-13-25)22-23-8-5-9-24-22;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-9,18-19H,1-4,10-15H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CKFLCGYZISELLF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|