About 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde
1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde (PubChem CID 174832471) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde |
| PubChem CID | 174832471 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde |
| SMILES | O=CC1=NCCN1CCO |
| InChI | InChI=1S/C6H10N2O2/c9-4-3-8-2-1-7-6(8)5-10/h5,9H,1-4H2 |
| InChIKey | KXDZWEGDNROKQU-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde?
The IUPAC name of 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde (CID 174832471) is 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde.
What is the SMILES notation for 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde?
The canonical SMILES for 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde is O=CC1=NCCN1CCO.
What is the InChIKey of 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde?
The InChIKey is KXDZWEGDNROKQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c9-4-3-8-2-1-7-6(8)5-10/h5,9H,1-4H2.
What are the key properties of 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde?
1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde has a molecular weight of 142.16 g/mol, XLogP of -1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-4,5-dihydroimidazole-2-carbaldehyde is sourced from PubChem (CID 174832471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).