C10H9F5O2S — CID 174832649
1,2,3,4,5-pentafluoro-6-(2-methylpropylsulfonyl)benzene (PubChem CID 174832649) has the molecular formula C10H9F5O2S and a molecular weight of 288.24 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2-methylpropylsulfonyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2-methylpropylsulfonyl)benzene |
|---|---|
| PubChem CID | 174832649 |
| Molecular Formula | C10H9F5O2S |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2-methylpropylsulfonyl)benzene |
| SMILES | CC(C)CS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H9F5O2S/c1-4(2)3-18(16,17)10-8(14)6(12)5(11)7(13)9(10)15/h4H,3H2,1-2H3 |
| InChIKey | QTXGBLXAHQUMFM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|