About cyclohexane-1,4-diol;ethoxyethane
cyclohexane-1,4-diol;ethoxyethane (PubChem CID 174832685) has the molecular formula C10H22O3
and a molecular weight of 190.28 g/mol. Its IUPAC name is cyclohexane-1,4-diol;ethoxyethane.
Molecular Properties
| Compound Name | cyclohexane-1,4-diol;ethoxyethane |
| PubChem CID | 174832685 |
| Molecular Formula | C10H22O3 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | cyclohexane-1,4-diol;ethoxyethane |
| SMILES | CCOCC.OC1CCC(O)CC1 |
| InChI | InChI=1S/C6H12O2.C4H10O/c7-5-1-2-6(8)4-3-5;1-3-5-4-2/h5-8H,1-4H2;3-4H2,1-2H3 |
| InChIKey | BVBJFJCUOKMNEF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexane-1,4-diol;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,4-diol;ethoxyethane?
The IUPAC name of cyclohexane-1,4-diol;ethoxyethane (CID 174832685) is cyclohexane-1,4-diol;ethoxyethane.
What is the SMILES notation for cyclohexane-1,4-diol;ethoxyethane?
The canonical SMILES for cyclohexane-1,4-diol;ethoxyethane is CCOCC.OC1CCC(O)CC1.
What is the InChIKey of cyclohexane-1,4-diol;ethoxyethane?
The InChIKey is BVBJFJCUOKMNEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C4H10O/c7-5-1-2-6(8)4-3-5;1-3-5-4-2/h5-8H,1-4H2;3-4H2,1-2H3.
What are the key properties of cyclohexane-1,4-diol;ethoxyethane?
cyclohexane-1,4-diol;ethoxyethane has a molecular weight of 190.28 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,4-diol;ethoxyethane is sourced from PubChem (CID 174832685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).