About ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate
ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate (PubChem CID 174833091) has the molecular formula C19H26F2N2O4
and a molecular weight of 384.42 g/mol. Its IUPAC name is ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate.
Molecular Properties
| Compound Name | ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate |
| PubChem CID | 174833091 |
| Molecular Formula | C19H26F2N2O4 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(OC(=O)C(C)(C)C)C(C)C2)c(F)c1F |
| InChI | InChI=1S/C19H26F2N2O4/c1-6-26-17(24)13-7-8-14(16(21)15(13)20)22-9-10-23(12(2)11-22)27-18(25)19(3,4)5/h7-8,12H,6,9-11H2,1-5H3 |
| InChIKey | ZOVSZWQRWJAMBK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate?
The IUPAC name of ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate (CID 174833091) is ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate.
What is the SMILES notation for ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate?
The canonical SMILES for ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate is CCOC(=O)c1ccc(N2CCN(OC(=O)C(C)(C)C)C(C)C2)c(F)c1F.
What is the InChIKey of ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate?
The InChIKey is ZOVSZWQRWJAMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26F2N2O4/c1-6-26-17(24)13-7-8-14(16(21)15(13)20)22-9-10-23(12(2)11-22)27-18(25)19(3,4)5/h7-8,12H,6,9-11H2,1-5H3.
What are the key properties of ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate?
ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate has a molecular weight of 384.42 g/mol, XLogP of 3.16, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4-(2,2-dimethylpropanoyloxy)-3-methylpiperazin-1-yl]-2,3-difluorobenzoate is sourced from PubChem (CID 174833091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).