About 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol
7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol (PubChem CID 174833705) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol.
Molecular Properties
| Compound Name | 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol |
| PubChem CID | 174833705 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol |
| SMILES | CC12C=CCCC1C(=O)OC2=O.[H]/N=C/CO |
| InChI | InChI=1S/C9H10O3.C2H5NO/c1-9-5-3-2-4-6(9)7(10)12-8(9)11;3-1-2-4/h3,5-6H,2,4H2,1H3;1,3-4H,2H2/b;3-1+ |
| InChIKey | ABPKWLNKCLBKLQ-NBPLQZBRSA-N |
| XLogP | 0.67 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol?
The IUPAC name of 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol (CID 174833705) is 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol.
What is the SMILES notation for 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol?
The canonical SMILES for 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol is CC12C=CCCC1C(=O)OC2=O.[H]/N=C/CO.
What is the InChIKey of 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol?
The InChIKey is ABPKWLNKCLBKLQ-NBPLQZBRSA-N. The full InChI is InChI=1S/C9H10O3.C2H5NO/c1-9-5-3-2-4-6(9)7(10)12-8(9)11;3-1-2-4/h3,5-6H,2,4H2,1H3;1,3-4H,2H2/b;3-1+.
What are the key properties of 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol?
7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol has a molecular weight of 225.24 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-methyl-4,5-dihydro-3aH-2-benzofuran-1,3-dione;2-iminoethanol is sourced from PubChem (CID 174833705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).