C32H24ClF3O2S — CID 174834184
2-(4-chlorophenyl)-4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene (PubChem CID 174834184) has the molecular formula C32H24ClF3O2S and a molecular weight of 565.06 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene.
| Compound Name | 2-(4-chlorophenyl)-4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174834184 |
| Molecular Formula | C32H24ClF3O2S |
| Molecular Weight | 565.06 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4-[2-methyl-5-(trifluoromethyl)phenyl]sulfonyl-1,2,3,4-tetrahydrochrysene |
| SMILES | Cc1ccc(C(F)(F)F)cc1S(=O)(=O)C1CC(c2ccc(Cl)cc2)Cc2ccc3c(ccc4ccccc43)c21 |
| InChI | InChI=1S/C32H24ClF3O2S/c1-19-6-11-24(32(34,35)36)18-29(19)39(37,38)30-17-23(20-7-12-25(33)13-8-20)16-22-10-14-27-26-5-3-2-4-21(26)9-15-28(27)31(22)30/h2-15,18,23,30H,16-17H2,1H3 |
| InChIKey | ZXTXBERXNJUVBB-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.06 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|