About (4S)-4-phenyl-4,5-dihydro-1,3-thiazole
(4S)-4-phenyl-4,5-dihydro-1,3-thiazole (PubChem CID 174834483) has the molecular formula C9H9NS
and a molecular weight of 163.25 g/mol. Its IUPAC name is (4S)-4-phenyl-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | (4S)-4-phenyl-4,5-dihydro-1,3-thiazole |
| PubChem CID | 174834483 |
| Molecular Formula | C9H9NS |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | (4S)-4-phenyl-4,5-dihydro-1,3-thiazole |
| SMILES | C1=N[C@@H](c2ccccc2)CS1 |
| InChI | InChI=1S/C9H9NS/c1-2-4-8(5-3-1)9-6-11-7-10-9/h1-5,7,9H,6H2/t9-/m1/s1 |
| InChIKey | CMIWIRFHWMTUFP-SECBINFHSA-N |
| XLogP | 2.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-phenyl-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-phenyl-4,5-dihydro-1,3-thiazole?
The IUPAC name of (4S)-4-phenyl-4,5-dihydro-1,3-thiazole (CID 174834483) is (4S)-4-phenyl-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for (4S)-4-phenyl-4,5-dihydro-1,3-thiazole?
The canonical SMILES for (4S)-4-phenyl-4,5-dihydro-1,3-thiazole is C1=N[C@@H](c2ccccc2)CS1.
What is the InChIKey of (4S)-4-phenyl-4,5-dihydro-1,3-thiazole?
The InChIKey is CMIWIRFHWMTUFP-SECBINFHSA-N. The full InChI is InChI=1S/C9H9NS/c1-2-4-8(5-3-1)9-6-11-7-10-9/h1-5,7,9H,6H2/t9-/m1/s1.
What are the key properties of (4S)-4-phenyl-4,5-dihydro-1,3-thiazole?
(4S)-4-phenyl-4,5-dihydro-1,3-thiazole has a molecular weight of 163.25 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-phenyl-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 174834483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).