About prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride
prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride (PubChem CID 174834513) has the molecular formula C13H30ClNO
and a molecular weight of 251.84 g/mol. Its IUPAC name is prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride.
Molecular Properties
| Compound Name | prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride |
| PubChem CID | 174834513 |
| Molecular Formula | C13H30ClNO |
| Molecular Weight | 251.84 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride |
| SMILES | C=CC.CCCCCOCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C10H24NO.C3H6.ClH/c1-5-6-7-9-12-10-8-11(2,3)4;1-3-2;/h5-10H2,1-4H3;3H,1H2,2H3;1H/q+1;;/p-1 |
| InChIKey | WNDRBPUZCFTWNE-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.84 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride?
The IUPAC name of prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride (CID 174834513) is prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride.
What is the SMILES notation for prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride?
The canonical SMILES for prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride is C=CC.CCCCCOCC[N+](C)(C)C.[Cl-].
What is the InChIKey of prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride?
The InChIKey is WNDRBPUZCFTWNE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H24NO.C3H6.ClH/c1-5-6-7-9-12-10-8-11(2,3)4;1-3-2;/h5-10H2,1-4H3;3H,1H2,2H3;1H/q+1;;/p-1.
What are the key properties of prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride?
prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride has a molecular weight of 251.84 g/mol, XLogP of 0.10, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene;trimethyl(2-pentoxyethyl)azanium;chloride is sourced from PubChem (CID 174834513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).