C13H24N2O — CID 174834679
N-methyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enamide (PubChem CID 174834679) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N-methyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enamide.
| Compound Name | N-methyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 174834679 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N-methyl-N-(2,2,6,6-tetramethylpiperidin-1-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(C)N1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C13H24N2O/c1-7-11(16)14(6)15-12(2,3)9-8-10-13(15,4)5/h7H,1,8-10H2,2-6H3 |
| InChIKey | KOIULLJUOMVMKN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|