About 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one
2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 174834868) has the molecular formula C17H28N2O2S
and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
Molecular Properties
| Compound Name | 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| PubChem CID | 174834868 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | C=CCN(CCCCC)C(=O)C(=C)C.O=C1C[C@H]2SCCN12 |
| InChI | InChI=1S/C12H21NO.C5H7NOS/c1-5-7-8-10-13(9-6-2)12(14)11(3)4;7-4-3-5-6(4)1-2-8-5/h6H,2-3,5,7-10H2,1,4H3;5H,1-3H2/t;5-/m.1/s1 |
| InChIKey | OUPZPGIHWYWSFM-QDXATWJZSA-N |
| XLogP | 3.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The IUPAC name of 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one (CID 174834868) is 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
What is the SMILES notation for 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The canonical SMILES for 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one is C=CCN(CCCCC)C(=O)C(=C)C.O=C1C[C@H]2SCCN12.
What is the InChIKey of 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
The InChIKey is OUPZPGIHWYWSFM-QDXATWJZSA-N. The full InChI is InChI=1S/C12H21NO.C5H7NOS/c1-5-7-8-10-13(9-6-2)12(14)11(3)4;7-4-3-5-6(4)1-2-8-5/h6H,2-3,5,7-10H2,1,4H3;5H,1-3H2/t;5-/m.1/s1.
What are the key properties of 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one?
2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one has a molecular weight of 324.49 g/mol, XLogP of 3.06, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-pentyl-N-prop-2-enylprop-2-enamide;(5R)-4-thia-1-azabicyclo[3.2.0]heptan-7-one is sourced from PubChem (CID 174834868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).