About 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride
7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride (PubChem CID 174834902) has the molecular formula C7H7Cl2FN2
and a molecular weight of 209.05 g/mol. Its IUPAC name is 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride.
Molecular Properties
| Compound Name | 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride |
| PubChem CID | 174834902 |
| Molecular Formula | C7H7Cl2FN2 |
| Molecular Weight | 209.05 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccnc2c1=NCC=2 |
| InChI | InChI=1S/C7H5FN2.2ClH/c8-5-1-3-9-6-2-4-10-7(5)6;;/h1-3H,4H2;2*1H |
| InChIKey | XHCDZNPUEMVVNP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.05 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
The IUPAC name of 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride (CID 174834902) is 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride.
What is the SMILES notation for 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
The canonical SMILES for 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride is Cl.Cl.Fc1ccnc2c1=NCC=2.
What is the InChIKey of 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
The InChIKey is XHCDZNPUEMVVNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2.2ClH/c8-5-1-3-9-6-2-4-10-7(5)6;;/h1-3H,4H2;2*1H.
What are the key properties of 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride has a molecular weight of 209.05 g/mol, XLogP of 0.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2H-pyrrolo[3,2-b]pyridine;dihydrochloride is sourced from PubChem (CID 174834902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).