About zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate)
zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) (PubChem CID 174835793) has the molecular formula C6H14O6S6Zn
and a molecular weight of 439.96 g/mol. Its IUPAC name is zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate).
Molecular Properties
| Compound Name | zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) |
| PubChem CID | 174835793 |
| Molecular Formula | C6H14O6S6Zn |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) |
| SMILES | CCC(S)(S)S(=O)(=O)[O-].CCC(S)(S)S(=O)(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C3H8O3S3.Zn/c2*1-2-3(7,8)9(4,5)6;/h2*7-8H,2H2,1H3,(H,4,5,6);/q;;+2/p-2 |
| InChIKey | ZUAIQABVHOHUNQ-UHFFFAOYSA-L |
| XLogP | 0.91 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate)?
The IUPAC name of zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) (CID 174835793) is zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate).
What is the SMILES notation for zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate)?
The canonical SMILES for zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) is CCC(S)(S)S(=O)(=O)[O-].CCC(S)(S)S(=O)(=O)[O-].[Zn+2].
What is the InChIKey of zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate)?
The InChIKey is ZUAIQABVHOHUNQ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H8O3S3.Zn/c2*1-2-3(7,8)9(4,5)6;/h2*7-8H,2H2,1H3,(H,4,5,6);/q;;+2/p-2.
What are the key properties of zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate)?
zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) has a molecular weight of 439.96 g/mol, XLogP of 0.91, 4 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(1,1-bis(sulfanyl)propane-1-sulfonate) is sourced from PubChem (CID 174835793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).