About N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid
N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid (PubChem CID 174836563) has the molecular formula C7H6F3N3O3
and a molecular weight of 237.14 g/mol. Its IUPAC name is N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid |
| PubChem CID | 174836563 |
| Molecular Formula | C7H6F3N3O3 |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=CNc1cnccn1 |
| InChI | InChI=1S/C5H5N3O.C2HF3O2/c9-4-8-5-3-6-1-2-7-5;3-2(4,5)1(6)7/h1-4H,(H,7,8,9);(H,6,7) |
| InChIKey | IHKNHZUPCONPKW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid?
The IUPAC name of N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid (CID 174836563) is N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.O=CNc1cnccn1.
What is the InChIKey of N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid?
The InChIKey is IHKNHZUPCONPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O.C2HF3O2/c9-4-8-5-3-6-1-2-7-5;3-2(4,5)1(6)7/h1-4H,(H,7,8,9);(H,6,7).
What are the key properties of N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid?
N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid has a molecular weight of 237.14 g/mol, XLogP of 0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrazin-2-ylformamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 174836563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).