About [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate
[(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174836994) has the molecular formula C16H22F3NO3
and a molecular weight of 333.35 g/mol. Its IUPAC name is [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate |
| PubChem CID | 174836994 |
| Molecular Formula | C16H22F3NO3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | C=CCC1(CC=C)C[C@@H](C(F)(F)F)N(OC(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H22F3NO3/c1-6-8-15(9-7-2)10-11(16(17,18)19)20(12(15)21)23-13(22)14(3,4)5/h6-7,11H,1-2,8-10H2,3-5H3/t11-/m0/s1 |
| InChIKey | MPQOGINGGDARJA-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
The IUPAC name of [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate (CID 174836994) is [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate is C=CCC1(CC=C)C[C@@H](C(F)(F)F)N(OC(=O)C(C)(C)C)C1=O.
What is the InChIKey of [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
The InChIKey is MPQOGINGGDARJA-NSHDSACASA-N. The full InChI is InChI=1S/C16H22F3NO3/c1-6-8-15(9-7-2)10-11(16(17,18)19)20(12(15)21)23-13(22)14(3,4)5/h6-7,11H,1-2,8-10H2,3-5H3/t11-/m0/s1.
What are the key properties of [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate?
[(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate has a molecular weight of 333.35 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-2-oxo-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-1-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174836994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).