About (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate
(5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate (PubChem CID 174836995) has the molecular formula C16H24F3NO3
and a molecular weight of 335.37 g/mol. Its IUPAC name is (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate.
Molecular Properties
| Compound Name | (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate |
| PubChem CID | 174836995 |
| Molecular Formula | C16H24F3NO3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate |
| SMILES | C=CCC1(CC=C)C[C@@H](C(F)(F)F)NC1=O.CC(C)(C)OC=O |
| InChI | InChI=1S/C11H14F3NO.C5H10O2/c1-3-5-10(6-4-2)7-8(11(12,13)14)15-9(10)16;1-5(2,3)7-4-6/h3-4,8H,1-2,5-7H2,(H,15,16);4H,1-3H3/t8-;/m0./s1 |
| InChIKey | HFWKEASNTDXOBP-QRPNPIFTSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate?
The IUPAC name of (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate (CID 174836995) is (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate.
What is the SMILES notation for (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate?
The canonical SMILES for (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate is C=CCC1(CC=C)C[C@@H](C(F)(F)F)NC1=O.CC(C)(C)OC=O.
What is the InChIKey of (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate?
The InChIKey is HFWKEASNTDXOBP-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H14F3NO.C5H10O2/c1-3-5-10(6-4-2)7-8(11(12,13)14)15-9(10)16;1-5(2,3)7-4-6/h3-4,8H,1-2,5-7H2,(H,15,16);4H,1-3H3/t8-;/m0./s1.
What are the key properties of (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate?
(5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate has a molecular weight of 335.37 g/mol, XLogP of 3.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one;tert-butyl formate is sourced from PubChem (CID 174836995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).