C11H14F3NO — CID 174836998
3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one (PubChem CID 174836998) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one.
| Compound Name | 3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 174836998 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3,3-bis(prop-2-enyl)-5-(trifluoromethyl)pyrrolidin-2-one |
| SMILES | C=CCC1(CC=C)CC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C11H14F3NO/c1-3-5-10(6-4-2)7-8(11(12,13)14)15-9(10)16/h3-4,8H,1-2,5-7H2,(H,15,16) |
| InChIKey | XXOQEAUQECZVQR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|