About 1,2-difluoro-4-methoxybenzene;oxolane
1,2-difluoro-4-methoxybenzene;oxolane (PubChem CID 174837143) has the molecular formula C11H14F2O2
and a molecular weight of 216.23 g/mol. Its IUPAC name is 1,2-difluoro-4-methoxybenzene;oxolane.
Molecular Properties
| Compound Name | 1,2-difluoro-4-methoxybenzene;oxolane |
| PubChem CID | 174837143 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1,2-difluoro-4-methoxybenzene;oxolane |
| SMILES | C1CCOC1.COc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C7H6F2O.C4H8O/c1-10-5-2-3-6(8)7(9)4-5;1-2-4-5-3-1/h2-4H,1H3;1-4H2 |
| InChIKey | AEFJMCUMWDJVKI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-difluoro-4-methoxybenzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-4-methoxybenzene;oxolane?
The IUPAC name of 1,2-difluoro-4-methoxybenzene;oxolane (CID 174837143) is 1,2-difluoro-4-methoxybenzene;oxolane.
What is the SMILES notation for 1,2-difluoro-4-methoxybenzene;oxolane?
The canonical SMILES for 1,2-difluoro-4-methoxybenzene;oxolane is C1CCOC1.COc1ccc(F)c(F)c1.
What is the InChIKey of 1,2-difluoro-4-methoxybenzene;oxolane?
The InChIKey is AEFJMCUMWDJVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2O.C4H8O/c1-10-5-2-3-6(8)7(9)4-5;1-2-4-5-3-1/h2-4H,1H3;1-4H2.
What are the key properties of 1,2-difluoro-4-methoxybenzene;oxolane?
1,2-difluoro-4-methoxybenzene;oxolane has a molecular weight of 216.23 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-4-methoxybenzene;oxolane is sourced from PubChem (CID 174837143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).