About 4-amino-2,3-dihydropyridine-2-thiol
4-amino-2,3-dihydropyridine-2-thiol (PubChem CID 174837604) has the molecular formula C5H8N2S
and a molecular weight of 128.20 g/mol. Its IUPAC name is 4-amino-2,3-dihydropyridine-2-thiol.
Molecular Properties
| Compound Name | 4-amino-2,3-dihydropyridine-2-thiol |
| PubChem CID | 174837604 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 4-amino-2,3-dihydropyridine-2-thiol |
| SMILES | NC1=CC=NC(S)C1 |
| InChI | InChI=1S/C5H8N2S/c6-4-1-2-7-5(8)3-4/h1-2,5,8H,3,6H2 |
| InChIKey | NTLAUHVTMRLMKH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,3-dihydropyridine-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,3-dihydropyridine-2-thiol?
The IUPAC name of 4-amino-2,3-dihydropyridine-2-thiol (CID 174837604) is 4-amino-2,3-dihydropyridine-2-thiol.
What is the SMILES notation for 4-amino-2,3-dihydropyridine-2-thiol?
The canonical SMILES for 4-amino-2,3-dihydropyridine-2-thiol is NC1=CC=NC(S)C1.
What is the InChIKey of 4-amino-2,3-dihydropyridine-2-thiol?
The InChIKey is NTLAUHVTMRLMKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S/c6-4-1-2-7-5(8)3-4/h1-2,5,8H,3,6H2.
What are the key properties of 4-amino-2,3-dihydropyridine-2-thiol?
4-amino-2,3-dihydropyridine-2-thiol has a molecular weight of 128.20 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dihydropyridine-2-thiol is sourced from PubChem (CID 174837604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).