About tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine
tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine (PubChem CID 174838718) has the molecular formula C18H28N2O2
and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine.
Molecular Properties
| Compound Name | tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine |
| PubChem CID | 174838718 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine |
| SMILES | CC(C)(C)OC=O.c1ccc([C@@H]2C[C@H]2NCC2CNC2)cc1 |
| InChI | InChI=1S/C13H18N2.C5H10O2/c1-2-4-11(5-3-1)12-6-13(12)15-9-10-7-14-8-10;1-5(2,3)7-4-6/h1-5,10,12-15H,6-9H2;4H,1-3H3/t12-,13+;/m0./s1 |
| InChIKey | NKTOAVCPMCSSIX-JHEYCYPBSA-N |
| XLogP | 2.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine?
The IUPAC name of tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine (CID 174838718) is tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine.
What is the SMILES notation for tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine?
The canonical SMILES for tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine is CC(C)(C)OC=O.c1ccc([C@@H]2C[C@H]2NCC2CNC2)cc1.
What is the InChIKey of tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine?
The InChIKey is NKTOAVCPMCSSIX-JHEYCYPBSA-N. The full InChI is InChI=1S/C13H18N2.C5H10O2/c1-2-4-11(5-3-1)12-6-13(12)15-9-10-7-14-8-10;1-5(2,3)7-4-6/h1-5,10,12-15H,6-9H2;4H,1-3H3/t12-,13+;/m0./s1.
What are the key properties of tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine?
tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine has a molecular weight of 304.43 g/mol, XLogP of 2.31, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;trans-(1R,2S)-N-(azetidin-3-ylmethyl)-2-phenylcyclopropan-1-amine is sourced from PubChem (CID 174838718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).