About (4-oxocyclohexyl) N-aminocarbamate
(4-oxocyclohexyl) N-aminocarbamate (PubChem CID 174838764) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is (4-oxocyclohexyl) N-aminocarbamate.
Molecular Properties
| Compound Name | (4-oxocyclohexyl) N-aminocarbamate |
| PubChem CID | 174838764 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (4-oxocyclohexyl) N-aminocarbamate |
| SMILES | NNC(=O)OC1CCC(=O)CC1 |
| InChI | InChI=1S/C7H12N2O3/c8-9-7(11)12-6-3-1-5(10)2-4-6/h6H,1-4,8H2,(H,9,11) |
| InChIKey | WMZSWIYKSFYLEA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-oxocyclohexyl) N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxocyclohexyl) N-aminocarbamate?
The IUPAC name of (4-oxocyclohexyl) N-aminocarbamate (CID 174838764) is (4-oxocyclohexyl) N-aminocarbamate.
What is the SMILES notation for (4-oxocyclohexyl) N-aminocarbamate?
The canonical SMILES for (4-oxocyclohexyl) N-aminocarbamate is NNC(=O)OC1CCC(=O)CC1.
What is the InChIKey of (4-oxocyclohexyl) N-aminocarbamate?
The InChIKey is WMZSWIYKSFYLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c8-9-7(11)12-6-3-1-5(10)2-4-6/h6H,1-4,8H2,(H,9,11).
What are the key properties of (4-oxocyclohexyl) N-aminocarbamate?
(4-oxocyclohexyl) N-aminocarbamate has a molecular weight of 172.18 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxocyclohexyl) N-aminocarbamate is sourced from PubChem (CID 174838764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).