About 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one
2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one (PubChem CID 174839518) has the molecular formula C24H16O2S
and a molecular weight of 368.46 g/mol. Its IUPAC name is 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one.
Molecular Properties
| Compound Name | 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one |
| PubChem CID | 174839518 |
| Molecular Formula | C24H16O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one |
| SMILES | O=c1c2c(oc3ccccc13)C(c1ccccc1)=CC(c1ccccc1)S2 |
| InChI | InChI=1S/C24H16O2S/c25-22-18-13-7-8-14-20(18)26-23-19(16-9-3-1-4-10-16)15-21(27-24(22)23)17-11-5-2-6-12-17/h1-15,21H |
| InChIKey | HDCLUCVJPHSNAC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one?
The IUPAC name of 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one (CID 174839518) is 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one.
What is the SMILES notation for 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one?
The canonical SMILES for 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one is O=c1c2c(oc3ccccc13)C(c1ccccc1)=CC(c1ccccc1)S2.
What is the InChIKey of 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one?
The InChIKey is HDCLUCVJPHSNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16O2S/c25-22-18-13-7-8-14-20(18)26-23-19(16-9-3-1-4-10-16)15-21(27-24(22)23)17-11-5-2-6-12-17/h1-15,21H.
What are the key properties of 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one?
2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one has a molecular weight of 368.46 g/mol, XLogP of 6.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diphenyl-2H-thiopyrano[3,2-b]chromen-10-one is sourced from PubChem (CID 174839518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).