About bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane
bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane (PubChem CID 174840112) has the molecular formula C5H10BrCl5
and a molecular weight of 327.30 g/mol. Its IUPAC name is bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane.
Molecular Properties
| Compound Name | bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane |
| PubChem CID | 174840112 |
| Molecular Formula | C5H10BrCl5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 323.84 |
| IUPAC Name | bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane |
| SMILES | CC(Cl)Cl.ClCBr.ClCCCl |
| InChI | InChI=1S/2C2H4Cl2.CH2BrCl/c1-2(3)4;3-1-2-4;2-1-3/h2H,1H3;1-2H2;1H2 |
| InChIKey | SUKNDVMZBLNZCX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane?
The IUPAC name of bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane (CID 174840112) is bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane.
What is the SMILES notation for bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane?
The canonical SMILES for bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane is CC(Cl)Cl.ClCBr.ClCCCl.
What is the InChIKey of bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane?
The InChIKey is SUKNDVMZBLNZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H4Cl2.CH2BrCl/c1-2(3)4;3-1-2-4;2-1-3/h2H,1H3;1-2H2;1H2.
What are the key properties of bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane?
bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane has a molecular weight of 327.30 g/mol, XLogP of 4.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(chloro)methane;1,1-dichloroethane;1,2-dichloroethane is sourced from PubChem (CID 174840112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).