About 4-(2,5-difluorophenyl)imidazolidine
4-(2,5-difluorophenyl)imidazolidine (PubChem CID 174840192) has the molecular formula C9H10F2N2
and a molecular weight of 184.19 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)imidazolidine.
Molecular Properties
| Compound Name | 4-(2,5-difluorophenyl)imidazolidine |
| PubChem CID | 174840192 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 4-(2,5-difluorophenyl)imidazolidine |
| SMILES | Fc1ccc(F)c(C2CNCN2)c1 |
| InChI | InChI=1S/C9H10F2N2/c10-6-1-2-8(11)7(3-6)9-4-12-5-13-9/h1-3,9,12-13H,4-5H2 |
| InChIKey | KEXQYDRIFSGISV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,5-difluorophenyl)imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-difluorophenyl)imidazolidine?
The IUPAC name of 4-(2,5-difluorophenyl)imidazolidine (CID 174840192) is 4-(2,5-difluorophenyl)imidazolidine.
What is the SMILES notation for 4-(2,5-difluorophenyl)imidazolidine?
The canonical SMILES for 4-(2,5-difluorophenyl)imidazolidine is Fc1ccc(F)c(C2CNCN2)c1.
What is the InChIKey of 4-(2,5-difluorophenyl)imidazolidine?
The InChIKey is KEXQYDRIFSGISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2/c10-6-1-2-8(11)7(3-6)9-4-12-5-13-9/h1-3,9,12-13H,4-5H2.
What are the key properties of 4-(2,5-difluorophenyl)imidazolidine?
4-(2,5-difluorophenyl)imidazolidine has a molecular weight of 184.19 g/mol, XLogP of 1.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-difluorophenyl)imidazolidine is sourced from PubChem (CID 174840192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).